73776-17-7 Usage
General Description
The chemical compound "3-Quinolinecarboxylic acid, 1,2-dihydro-2-oxo-, Methyl ester" is a methyl ester derivative of 3-quinolinecarboxylic acid. It is a yellow solid with a molecular formula of C11H9NO3 and a molecular weight of 203.2 g/mol. 3-Quinolinecarboxylic acid, 1,2-dihydro-2-oxo-, Methyl ester is often used as a building block in the synthesis of various organic compounds and pharmaceutical intermediates. Its derivatives have shown potential biological activities, including antimicrobial, antifungal, and antiviral properties. Additionally, 3-Quinolinecarboxylic acid, 1,2-dihydro-2-oxo-, Methyl ester has been studied for its potential application in the treatment of various diseases and as a potential drug candidate for future pharmaceutical development.
Check Digit Verification of cas no
The CAS Registry Mumber 73776-17-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,7,7 and 6 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 73776-17:
(7*7)+(6*3)+(5*7)+(4*7)+(3*6)+(2*1)+(1*7)=157
157 % 10 = 7
So 73776-17-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO3/c1-15-11(14)8-6-7-4-2-3-5-9(7)12-10(8)13/h2-6H,1H3,(H,12,13)
