7402-16-6 Usage
General Description
8-Amino-quinolin-6-ol is a chemical compound with the molecular formula C9H8N2O. It is an aromatic compound belonging to the quinoline family, and it contains an amino group and a hydroxyl group attached to the quinoline ring. This chemical is used in various applications such as pharmaceuticals and dye intermediates. It has been studied for its potential biological activities including anti-inflammatory, anti-cancer, and antimicrobial properties. Additionally, 8-amino-quinolin-6-ol has been investigated for its role in the synthesis of organic compounds and coordination chemistry. Overall, this chemical compound has diverse potential applications and properties that make it an important area of research in the field of organic chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 7402-16-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,0 and 2 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 7402-16:
(6*7)+(5*4)+(4*0)+(3*2)+(2*1)+(1*6)=76
76 % 10 = 6
So 7402-16-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O/c10-8-5-7(12)4-6-2-1-3-11-9(6)8/h1-5,12H,10H2
7402-16-6Relevant articles and documents
COMPOSITIONS AND METHODS FOR TREATING AND PREVENTING CANCER
-
Page/Page column 78-80, (2016/12/12)
This invention is in the field of medicinal chemistry. In particular, the invention relates to novel small molecule compounds having a quinolin-8-yl-nicotinamide structure which are useful in treating, ameliorating, or preventing various forms of cancer (e.g., pancreatic cancer).
