74332-92-6 Usage
Description
Pyrrolo(2,1-a)isoquinoline, 1,2,3,5,6,7,8,9,10,10b-decahydro-5,5-dimethylis a bicyclic heteroaromatic compound with a complex molecular structure. It belongs to the pyrroloisoquinoline family and consists of 10 carbon atoms and 2 nitrogen atoms, featuring two methyl groups attached to the 5th and 5th carbon atoms. Pyrrolo(2,1-a)isoquinoline, 1,2,3,5,6,7,8,9,10,10b-decahydro-5,5-dimet hylhas potential pharmaceutical applications and is valuable for research and development in the field of medicinal chemistry.
Uses
Used in Pharmaceutical Applications:
Pyrrolo(2,1-a)isoquinoline, 1,2,3,5,6,7,8,9,10,10b-decahydro-5,5-dimethylis utilized as a pharmaceutical compound for its potential medicinal properties. Its unique structure and heteroatoms make it a promising candidate for the development of new drugs and therapeutic agents.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, Pyrrolo(2,1-a)isoquinoline, 1,2,3,5,6,7,8,9,10,10b-decahydro-5,5-dimethylserves as a key compound for research and development. Scientists can study its properties, interactions, and potential applications to create innovative treatments and therapies for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 74332-92-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,3,3 and 2 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 74332-92:
(7*7)+(6*4)+(5*3)+(4*3)+(3*2)+(2*9)+(1*2)=126
126 % 10 = 6
So 74332-92-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H23N/c1-14(2)10-11-6-3-4-7-12(11)13-8-5-9-15(13)14/h13H,3-10H2,1-2H3
