7462-41-1 Usage
Chemical derivation
Derived from D-mannitol.
Benzoyl groups
Hexabenzoyl indicates the presence of six benzoyl groups.
Attachment points
Benzoyl groups are attached to the six hydroxyl groups on the mannitol molecule.
Usage in organic chemistry
Extensively used in organic chemistry for various applications.
Protecting group
Employed as a protecting group to shield hydroxyl groups of mannitol.
Selective modification
Allows for selective modification of other parts of the molecule.
Reagent
Used as a reagent for the synthesis of other organic compounds.
Facilitates chemical reactions
Valuable for its ability to facilitate specific chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 7462-41-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,6 and 2 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 7462-41:
(6*7)+(5*4)+(4*6)+(3*2)+(2*4)+(1*1)=101
101 % 10 = 1
So 7462-41-1 is a valid CAS Registry Number.
InChI:InChI=1/C48H38O12/c49-43(33-19-7-1-8-20-33)55-31-39(57-45(51)35-23-11-3-12-24-35)41(59-47(53)37-27-15-5-16-28-37)42(60-48(54)38-29-17-6-18-30-38)40(58-46(52)36-25-13-4-14-26-36)32-56-44(50)34-21-9-2-10-22-34/h1-30,39-42H,31-32H2