7470-17-9 Usage
Molecular Weight
266.39 g/mol
Structure
A complex, saturated hydrocarbon with a carboxylic acid functional group attached to the 9th carbon atom.
Functional Groups
Carboxylic acid (-COOH)
Physical State
Likely a solid at room temperature due to its molecular size and complexity.
Solubility
Expected to be soluble in organic solvents such as ethanol, methanol, and acetone, but insoluble in water due to its nonpolar nature.
Reactivity
The carboxylic acid functional group can participate in various reactions, such as esterification, amide formation, and acid-base reactions.
Applications
Potential uses in pharmaceuticals, agrochemicals, and materials science, depending on its specific properties and reactivity.
Research and Experimentation
Further research and experimentation are needed to fully understand its potential and optimize its applications.
Synthesis
The synthesis of this compound may involve multiple steps, including the formation of the dodecahydrophenanthrene core and subsequent introduction of the carboxylic acid functional group.
Stability
The compound's stability may depend on factors such as temperature, pH, and exposure to light or air.
Safety
As with any chemical compound, appropriate safety measures should be taken when handling and working with 1,2,3,4,4a,4b,5,6,7,8,8a,10a-dodecahydrophenanthrene-9-carboxylic acid, including the use of personal protective equipment and proper disposal methods.
Check Digit Verification of cas no
The CAS Registry Mumber 7470-17-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,7 and 0 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7470-17:
(6*7)+(5*4)+(4*7)+(3*0)+(2*1)+(1*7)=99
99 % 10 = 9
So 7470-17-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H22O2/c16-15(17)14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h9-13H,1-8H2,(H,16,17)
