7471-06-9 Usage
General Description
1H-Benzimidazole,4-ethoxy-(9CI) is a chemical compound with the molecular formula C9H10N2O. It is a derivative of benzimidazole, which is a heterocyclic compound containing a fused benzene and imidazole ring. The addition of the ethoxy group to the benzimidazole structure imparts specific properties and functional characteristics to the compound. This chemical may have applications in various industries, including pharmaceuticals, agriculture, and materials science, due to its unique properties and potential for chemical reactivity. Further research and analysis of this compound are necessary to fully understand its potential uses and impacts.
Check Digit Verification of cas no
The CAS Registry Mumber 7471-06-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,7 and 1 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 7471-06:
(6*7)+(5*4)+(4*7)+(3*1)+(2*0)+(1*6)=99
99 % 10 = 9
So 7471-06-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O/c1-2-12-8-5-3-4-7-9(8)11-6-10-7/h3-6H,2H2,1H3,(H,10,11)
