7499-13-0 Usage
Description
1-(1-Cyclohexen-1-yl)ethanone semicarbazone is a chemical compound with the molecular formula C10H17N3O. It is a semicarbazone derivative of 1-(1-cyclohexen-1-yl)ethanone, characterized by a cyclohexene ring and an ethanone moiety, with a semicarbazone functional group attached to the carbonyl carbon. This yellow solid at room temperature has a melting point of 153-155°C and is of interest in organic and pharmaceutical chemistry due to its chemical properties and potential biological activities.
Uses
Used in Pharmaceutical Chemistry:
1-(1-Cyclohexen-1-yl)ethanone semicarbazone is used as a compound in the development of new drugs, leveraging its unique chemical structure and properties to create novel therapeutic agents.
Used in Organic Synthesis:
In the field of organic chemistry, 1-(1-Cyclohexen-1-yl)ethanone semicarbazone serves as a reagent, contributing to the synthesis of various organic compounds and facilitating chemical reactions.
Used in Research and Development:
Due to its potential biological activities and chemical properties, 1-(1-Cyclohexen-1-yl)ethanone semicarbazone is used as a target for further studies and investigations, aiming to explore its full potential in both pharmaceutical and chemical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 7499-13-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,9 and 9 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 7499-13:
(6*7)+(5*4)+(4*9)+(3*9)+(2*1)+(1*3)=130
130 % 10 = 0
So 7499-13-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H15N3O/c1-7(11-12-9(10)13)8-5-3-2-4-6-8/h5H,2-4,6H2,1H3,(H3,10,12,13)/b11-7+
