7499-32-3 Usage
General Description
9,10-Dihydro-7-methylbenzo[a]pyrene is a polycyclic aromatic hydrocarbon (PAH) that is formed during the incomplete combustion of organic matter, such as fossil fuels and tobacco smoke. It is a potent carcinogen and mutagen, and has been associated with the development of various types of cancer, particularly lung cancer. 9,10-Dihydro-7-methylbenzo[a]pyrene is formed in the body through the metabolism of other PAHs and can bind to DNA, leading to the formation of DNA adducts and potentially causing mutations. This chemical is considered to be a significant environmental pollutant and poses a health risk to humans and the environment. Efforts to reduce exposure to this chemical, through improved air quality and smoking cessation, are important for public health.
Check Digit Verification of cas no
The CAS Registry Mumber 7499-32-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,9 and 9 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7499-32:
(6*7)+(5*4)+(4*9)+(3*9)+(2*3)+(1*2)=133
133 % 10 = 3
So 7499-32-3 is a valid CAS Registry Number.
InChI:InChI=1/C21H16/c1-13-4-2-7-17-18-11-10-15-6-3-5-14-8-9-16(12-19(13)17)21(18)20(14)15/h3-6,8-12H,2,7H2,1H3