7500-78-9 Usage
Description
Benzamide, 2-benzoyl-, also known as 2-Benzoylbenzamide, is an organic compound that serves as a key reactant in the synthesis of various pharmaceutical agents. It is characterized by the presence of a benzoyl group attached to a benzene ring, which contributes to its reactivity and potential applications in the chemical and pharmaceutical industries.
Uses
Used in Pharmaceutical Industry:
Benzamide, 2-benzoyl-, is used as a reactant for the synthesis of 2,4-benzodiazepin-1-ones, which are potent central nervous system (CNS) agents. These benzodiazepin-1-ones have potential therapeutic applications in the treatment of various CNS disorders, such as anxiety, insomnia, and seizures, due to their ability to modulate the activity of specific neurotransmitter receptors in the brain.
Check Digit Verification of cas no
The CAS Registry Mumber 7500-78-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,0 and 0 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 7500-78:
(6*7)+(5*5)+(4*0)+(3*0)+(2*7)+(1*8)=89
89 % 10 = 9
So 7500-78-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H11NO2/c15-14(17)12-9-5-4-8-11(12)13(16)10-6-2-1-3-7-10/h1-9H,(H2,15,17)
7500-78-9Relevant articles and documents
Synthetic method of 2-chloro-4-phenyl quinazoline
-
, (2017/09/01)
The invention relates to a synthetic method of 2-chloro-4-phenyl quinazoline and belongs to the technical field of organic synthetic chemistry. The synthetic method comprises the following steps of: by taking o-benzoylbenzoic acid as a raw material, performing an acylating chlorination reaction to generate o-benzoyl benzoyl chloride; performing an amidation reaction to generate o-benzoyl benzamide; performing a Hofmann degradation reaction to generate 2-amino benzophenone; and performing an annulations reaction to generate 4-phenyl quinazoline-2(1H)-one and chlorinating the 4-phenyl quinazoline-2(1H)-one by phosphorus oxychloride to finally generate 2-chloro-4-phenyl quinazoline, wherein the total yield is 20.8%. Compared with other methods, the reagents used by the route are low in price and easily available, and the post-treatment is simple. In the reaction process, the reaction conditions and synthetic processes thereof are explored, so that a simple and feasible synthetic route is provided for synthesizing 2-chloro-4-phenyl quinazoline, thereby realizing amplified production.
