7501-09-9 Usage
General Description
CHEMBRDG-BB 7022461 is a chemical compound with the molecular formula C24H26N2O2. It is categorized as an aminopropyl carbazole derivative, and is often used in research and development for its potential pharmaceutical applications. The compound has been shown to exhibit antimicrobial and antifungal activity, and may have potential as an anticancer agent as well. Its structure and properties make it a promising candidate for further investigation and potential therapeutic use.
Check Digit Verification of cas no
The CAS Registry Mumber 7501-09-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,0 and 1 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 7501-09:
(6*7)+(5*5)+(4*0)+(3*1)+(2*0)+(1*9)=79
79 % 10 = 9
So 7501-09-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H12O3/c1-3-4-8-7-9(11(12)13)5-6-10(8)14-2/h3,5-7H,1,4H2,2H3,(H,12,13)
7501-09-9Relevant articles and documents
1-(PIPERIDIN-4-YL)-1H-INDOLE DERIVATIVE
-
Page/Page column 53, (2010/11/28)
The present invention provides a compound represented by the formula (1) or a pharmacologically acceptable salt thereof, or a hydrate thereof (provided that a compound in which all of R4a, R4b, and R4c are hydrogen atoms is excluded.): [wherein R1 represents a hydrogen atom, R2 represents a hydrogen atom, R3 represents the formula: wherein R4a, R4b, and R4c are the same as or different from each other and each represents a hydrogen atom, a C1-6 alkyl group or a C1-6 alkoxy group, etc.]
