7510-61-4 Usage
Explanation
Different sources of media describe the Explanation of 7510-61-4 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule of the compound.
2. Potential dye precursor
2. It can be used as a starting material for the synthesis of dyes, which have various applications in industries such as textiles, plastics, and printing.
3. Applications in electronics and materials science
3. The compound may have properties that make it suitable for use in the development of electronic devices or materials with specific characteristics, such as conductivity or mechanical strength.
4. Ester derivative
4. It is a compound formed by the reaction between an alcohol and an acid, resulting in the formation of an ester linkage.
5. Two 3,5-dinitrobenzoyl groups
5. The compound contains two nitrobenzoyl groups, which are aromatic rings with nitro substituents at the 3 and 5 positions.
6. Propan-2-yl group
6. A three-carbon alkyl group with a hydroxyl group attached to the second carbon, which is involved in the formation of the ester linkage.
7. Reagent in chemical synthesis
7. It can be used as a starting material or intermediate in the synthesis of other chemical compounds.
8. Building block for new materials
8. The compound can be used to create new materials with specific properties by incorporating it into their molecular structure.
9. Presence of nitro groups
9. The compound contains nitro groups (-NO2), which are known for their reactivity and can participate in various chemical reactions.
10. Careful handling and storage
10. Due to the potential reactivity of the nitro groups, the compound should be handled and stored with caution to prevent accidents or unwanted reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 7510-61-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,1 and 0 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 7510-61:
(6*7)+(5*5)+(4*1)+(3*0)+(2*6)+(1*1)=84
84 % 10 = 4
So 7510-61-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H12N4O12/c1-9(33-17(23)11-4-14(20(28)29)7-15(5-11)21(30)31)8-32-16(22)10-2-12(18(24)25)6-13(3-10)19(26)27/h2-7,9H,8H2,1H3