75181-07-6 Usage
Description
Pentamethylcyclopentadienyl zirconium trichloride is a chemical compound that serves as a catalyst in various chemical reactions. It is characterized by its ability to facilitate cross-coupling reactions and living polymerizations, making it a valuable component in the field of organic chemistry.
Uses
Used in Cross-coupling Reactions:
Pentamethylcyclopentadienyl zirconium trichloride is used as a catalyst for the cross-coupling reaction of aryl fluorides with phenethyl Grignard reagents. Its application in this process enhances the efficiency and selectivity of the reaction, leading to the formation of desired products with improved yields.
Used in Living Polymerizations:
In the polymer industry, Pentamethylcyclopentadienyl zirconium trichloride is used as a catalyst for living polymerizations of propylene. Its role in this process allows for better control over the molecular weight and polydispersity of the resulting polymers, which is crucial for the development of materials with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 75181-07-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,1,8 and 1 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 75181-07:
(7*7)+(6*5)+(5*1)+(4*8)+(3*1)+(2*0)+(1*7)=126
126 % 10 = 6
So 75181-07-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H15.3ClH.Zr/c1-6-7(2)9(4)10(5)8(6)3;;;;/h1-5H3;3*1H;/q-1;;;;+3/p-3/rC10H15.Cl3Zr/c1-6-7(2)9(4)10(5)8(6)3;1-4(2)3/h1-5H3;/q-1;
