75273-96-0 Usage
Organic compound
Yes
It is a compound primarily containing carbon and hydrogen atoms, with other elements such as nitrogen and oxygen also present.
Monohydrochloride salt
Yes
The compound is a salt formed by the reaction of the parent organic compound with hydrochloric acid (HCl), resulting in the addition of a positively charged hydrogen ion (H+) to the molecule.
Potential applications
Pharmaceutical and chemical industries
The compound may be used in the synthesis of various pharmaceuticals and as a reagent in organic chemical reactions, indicating its versatility and potential for further development.
Biological activities
Possible
The compound may exhibit biological activities, making it a potential candidate for use in drug discovery and development as a research tool.
Further research
Required
Additional investigation and research are needed to better understand the compound's properties, potential uses, and applications in various fields.
Structure
Complex aromatic system
The compound features a complex arrangement of aromatic rings, including a pyridine ring and a phenyl ring, connected through various functional groups such as amide and methylene linkages.
Solubility
May vary depending on solvent
The solubility of the compound in different solvents (e.g., water, organic solvents) may vary due to its molecular structure and the presence of polar and nonpolar regions.
Stability
May be affected by environmental factors
The stability of the compound could be influenced by factors such as temperature, pH, and exposure to light or air, which may impact its reactivity and shelf life.
Synthesis
Multi-step process
The synthesis of 1-(3-((4-Pyridinylmethylene)amino)phenyl)ethanone monohydrochloride likely involves a series of chemical reactions, including the formation of the aromatic rings, the introduction of functional groups, and the final reaction with hydrochloric acid to form the monohydrochloride salt.
Check Digit Verification of cas no
The CAS Registry Mumber 75273-96-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,2,7 and 3 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 75273-96:
(7*7)+(6*5)+(5*2)+(4*7)+(3*3)+(2*9)+(1*6)=150
150 % 10 = 0
So 75273-96-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H12N2O.ClH/c1-11(17)13-3-2-4-14(9-13)16-10-12-5-7-15-8-6-12;/h2-10H,1H3;1H/b16-10+;
