7529-87-5 Usage
General Description
Monoisopropyl fumarate is a chemical compound that is commonly used as a crosslinking agent in the production of various materials, such as coatings, adhesives, and resins. It is a derivative of fumaric acid and is known for its ability to improve the flexibility, durability, and mechanical properties of the materials it is added to. Monoisopropyl fumarate is also used in the pharmaceutical industry as an intermediate in the synthesis of various drugs and can serve as a stabilizer and antioxidant in food packaging materials. It has low toxicity and is considered to be relatively safe for handling and use, making it a versatile and valuable chemical for a wide range of industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 7529-87-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,2 and 9 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7529-87:
(6*7)+(5*5)+(4*2)+(3*9)+(2*8)+(1*7)=125
125 % 10 = 5
So 7529-87-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H10O4/c1-5(2)11-7(10)4-3-6(8)9/h3-5H,1-2H3,(H,8,9)/b4-3+
7529-87-5Relevant articles and documents
Kras-G12C inhibitor heterocyclic compounds
-
Paragraph 0217; 0220-0223, (2021/06/23)
The invention relates to Kras-G12C inhibitor heterocyclic compounds represented by formula I, a preparation method thereof, and application of the Kras-G12C inhibitor heterocyclic compounds in prevention and treatment of tumor diseases such as lung cancer, colorectal cancer and pancreatic cancer. In the preparation process, the compounds of the general formula I are obtained through a series of reactions such as SN2 reaction, protection, coupling reaction, deprotection, condensation reaction and the like.
Fumaric acid derivative and polymer therefrom
-
, (2008/06/13)
A polymer obtained by polymerizing a fumaric acid derivative represented by the following general formula (1): STR1 in which R1 represents an alkyl group having 1-6 carbon atoms and A denotes a radical of STR2 in which R2 and R3 represent each an alkyl group having 1-4 carbon atoms and may be identical with or different from each other, R4 denotes an alkyl group having 1-6 carbon atoms or a benzyl group and m and n denote each an integer of 1-6.
