7532-52-7 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule of the compound.
Explanation
This describes the specific arrangement of atoms and bonds in the molecule, which determines its chemical properties and reactivity.
3. Nitrofuran Derivative
Explanation
The compound is derived from a nitrofuran, which is a type of organic compound containing a furan ring with a nitro group attached.
4. Triazolamine Ring
Explanation
The compound contains a triazolamine ring, which is a five-membered ring with three nitrogen atoms and two carbon atoms.
5. Pharmaceutical and Agrochemical Synthesis
Explanation
It is used as a building block or intermediate in the synthesis of various pharmaceuticals and agrochemicals due to its unique chemical structure.
6. Antimicrobial and Antifungal Properties
Explanation
The compound has shown potential as an antimicrobial and antifungal agent, which means it can inhibit the growth of microorganisms, including bacteria and fungi.
7. Organic Dye Production
Explanation
It is utilized in the production of organic dyes, which are used to color various materials, such as fabrics, plastics, and inks.
8. Building Block for Organic Compounds
Explanation
The compound serves as a building block for the creation of diverse organic compounds, which can be used in various applications, including the development of new drugs and materials.
9. Promising Biological Activities
Chemical Structure
1H-1,2,4-Triazol-5-amine, 3-(5-nitro-2-furyl)-
Check Digit Verification of cas no
The CAS Registry Mumber 7532-52-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,3 and 2 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7532-52:
(6*7)+(5*5)+(4*3)+(3*2)+(2*5)+(1*2)=97
97 % 10 = 7
So 7532-52-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N5O3/c7-6-8-5(9-10-6)3-1-2-4(14-3)11(12)13/h1-2H,(H3,7,8,9,10)
