7547-47-9 Usage
Description
[[4-[(2-cyanoethyl)ethylamino]-2-methylphenyl]methylene]malononitrile is a chemical compound characterized by its molecular formula C17H16N4 and a molar mass of 268.34 g/mol. This yellow crystalline solid is renowned for its strong fluorescence properties, making it a valuable asset in various scientific fields.
Uses
Used in Organic Chemistry:
[[4-[(2-cyanoethyl)ethylamino]-2-methylphenyl]methylene]malononitrile is utilized as a reagent in organic chemistry due to its unique chemical structure and strong fluorescence properties. It aids in facilitating specific chemical reactions and enhancing the understanding of molecular interactions.
Used in Biochemistry and Materials Science:
In the fields of biochemistry and materials science, this compound serves as a vital tool. Its fluorescent nature allows for the tracking and analysis of biological processes, contributing to advancements in these scientific domains.
Used as a Fluorescent Tracer in Biological and Environmental Research:
[[4-[(2-cyanoethyl)ethylamino]-2-methylphenyl]methylene]malononitrile is employed as a fluorescent tracer in biological and environmental research. Its ability to emit strong fluorescence makes it an ideal candidate for tracking and identifying various biological and environmental samples.
Used in the Production of Photoconductors and Photochromic Materials:
[[4-[(2-cyanoethyl)ethylamino]-2-methylphenyl]methylene]malononitrile is a popular ingredient in the creation of photoconductors and photochromic materials. Its strong fluorescence properties enhance the performance and efficiency of these materials, making them more effective for various applications.
Used as a Pigment in Inks, Paints, and Plastics:
[[4-[(2-cyanoethyl)ethylamino]-2-methylphenyl]methylene]malononitrile is also used as a pigment in the production of inks, paints, and plastics. Its vibrant yellow color and strong fluorescence properties contribute to the creation of more vibrant and long-lasting colorants in these industries.
Check Digit Verification of cas no
The CAS Registry Mumber 7547-47-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,4 and 7 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7547-47:
(6*7)+(5*5)+(4*4)+(3*7)+(2*4)+(1*7)=119
119 % 10 = 9
So 7547-47-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H16N4/c1-3-20(8-4-7-17)16-6-5-15(13(2)9-16)10-14(11-18)12-19/h5-6,9-10H,3-4,8H2,1-2H3
