75493-93-5 Usage
General Description
1,2,3,4-tetrahydroquinoline-2-carboxylic acid hydrochloride is a chemical compound with potential pharmaceutical applications. It is a derivative of quinoline and contains a carboxylic acid group, making it applicable in medicinal chemistry for the development of new drugs. The hydrochloride salt form of the compound increases its solubility and stability, making it more suitable for pharmaceutical formulations. Its chemical structure and properties make it potentially useful for the treatment of various diseases and conditions, and it is an area of interest for further research and development in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 75493-93-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,4,9 and 3 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 75493-93:
(7*7)+(6*5)+(5*4)+(4*9)+(3*3)+(2*9)+(1*3)=165
165 % 10 = 5
So 75493-93-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO2.ClH/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-4,9,11H,5-6H2,(H,12,13);1H