756754-04-8 Usage
General Description
Glycine, N-[(3-methoxyphenyl)methyl]- (9CI) is a chemical compound with the molecular formula C10H13NO3. It is a derivative of glycine, a non-essential amino acid that plays a crucial role in the synthesis of proteins and other important molecules in the body. The addition of the (3-methoxyphenyl)methyl group to glycine creates a compound with potential pharmaceutical applications, particularly in the development of new drugs. Glycine, N-[(3-methoxyphenyl)methyl]- (9CI) may have properties that make it suitable for use in the treatment of various medical conditions, but further research is needed to fully understand its potential benefits and risks. As a result, Glycine, N-[(3-methoxyphenyl)methyl]- (9CI) is an area of interest for future studies and pharmaceutical development.
Check Digit Verification of cas no
The CAS Registry Mumber 756754-04-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,5,6,7,5 and 4 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 756754-04:
(8*7)+(7*5)+(6*6)+(5*7)+(4*5)+(3*4)+(2*0)+(1*4)=198
198 % 10 = 8
So 756754-04-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H13NO3/c1-14-9-4-2-3-8(5-9)6-11-7-10(12)13/h2-5,11H,6-7H2,1H3,(H,12,13)