75705-21-4 Usage
Description
4-Aminomethylphenylboronic acid hydrochloride, also known as A292475, is a pale yellow powder that is the salt form of A292475. It is a chemical compound with a unique structure that has potential applications in various fields.
Uses
Used in Chemical Synthesis:
4-Aminomethylphenylboronic acid hydrochloride is used as a chemical intermediate for the synthesis of various organic compounds. Its boronic acid group allows it to undergo reactions with other molecules, making it a versatile building block in organic chemistry.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-Aminomethylphenylboronic acid hydrochloride is used as a precursor for the development of new drugs. Its unique structure can be modified to create new compounds with potential therapeutic properties.
Used in Material Science:
4-Aminomethylphenylboronic acid hydrochloride is also used in material science for the development of new materials with specific properties. Its ability to form covalent bonds with other molecules can be utilized to create materials with tailored characteristics.
Overall, 4-Aminomethylphenylboronic acid hydrochloride is a versatile chemical compound with a wide range of applications in various industries, including chemical synthesis, pharmaceuticals, and material science. Its unique structure and properties make it a valuable building block for the development of new compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 75705-21-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,7,0 and 5 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 75705-21:
(7*7)+(6*5)+(5*7)+(4*0)+(3*5)+(2*2)+(1*1)=134
134 % 10 = 4
So 75705-21-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H10BNO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,10-11H,5,9H2
