7596-82-9 Usage
General Description
3-(Piperidinomethyl)benzoic acid hydrochloride 0.5 hydrate is a chemical compound that contains a piperidinomethyl group attached to a benzoic acid molecule and a hydrochloride salt. It is also in a 0.5 hydrate form, meaning it contains half a molecule of water for every molecule of the compound. This chemical may have applications in the pharmaceutical industry, potentially as a building block for drug synthesis, due to its unique structure and properties. It could also be used as a reagent in organic chemistry reactions. The hydrate form of the compound may impact its solubility and stability, which can be important factors for its use in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 7596-82-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,9 and 6 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7596-82:
(6*7)+(5*5)+(4*9)+(3*6)+(2*8)+(1*2)=139
139 % 10 = 9
So 7596-82-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H17NO2/c15-13(16)12-6-4-5-11(9-12)10-14-7-2-1-3-8-14/h4-6,9H,1-3,7-8,10H2,(H,15,16)
