7598-68-7 Usage
Description
[[2,2-Dimethoxy-1-(4-methoxyphenyl)ethylidene]amino]urea is a chemical compound characterized by the molecular formula C12H16N2O4. It is a derivative of urea, featuring an ethylideneamino group and two dimethoxy groups attached to a 4-methoxyphenyl ring. [[2,2-Dimethoxy-1-(4-methoxyphenyl)ethylidene]amino]urea holds significant interest in the fields of medicinal and pharmaceutical research due to its potential as a bioactive molecule. Its unique chemical structure and properties also make it a promising candidate for further investigation in organic and bioorganic chemistry.
Uses
Used in Pharmaceutical Research:
[[2,2-Dimethoxy-1-(4-methoxyphenyl)ethylidene]amino]urea is used as a potential bioactive molecule for drug development. Its unique structure allows for the synthesis of new compounds with possible pharmacological effects, contributing to the advancement of medicinal chemistry.
Used in Organic and Bioorganic Chemistry:
[[2,2-Dimethoxy-1-(4-methoxyphenyl)ethylidene]amino]urea is also utilized as a subject of study in organic and bioorganic chemistry. Its chemical properties and structure offer opportunities for further research and understanding of its potential applications in these scientific domains.
Check Digit Verification of cas no
The CAS Registry Mumber 7598-68-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,9 and 8 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 7598-68:
(6*7)+(5*5)+(4*9)+(3*8)+(2*6)+(1*8)=147
147 % 10 = 7
So 7598-68-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H17N3O4/c1-17-9-6-4-8(5-7-9)10(11(18-2)19-3)14-15-12(13)16/h4-7,11H,1-3H3,(H3,13,15,16)/b14-10-
