7599-19-1 Usage
Description
[1,3-dibenzoyloxy-1-(2-phenyltriazol-4-yl)propan-2-yl] benzoate is a complex chemical compound belonging to the benzoate ester family. It is derived from benzoic acid and features benzoyloxy and phenyltriazol groups in its structure. [1,3-dibenzoyloxy-1-(2-phenyltriazol-4-yl)propan-2-yl] benzoate is of interest to organic and pharmaceutical chemists due to its potential applications in pharmaceutical or medicinal research, driven by its unique structure and reactivity. Further laboratory testing and analysis are required to determine its specific properties and potential uses, which may include implications in the development of new drugs or materials.
Uses
Used in Pharmaceutical Research:
[1,3-dibenzoyloxy-1-(2-phenyltriazol-4-yl)propan-2-yl] benzoate is used as a research compound for its potential applications in the pharmaceutical industry. Its unique structure and reactivity make it a promising candidate for the development of new drugs or materials.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, [1,3-dibenzoyloxy-1-(2-phenyltriazol-4-yl)propan-2-yl] benzoate is used as a chemical intermediate or building block for the synthesis of more complex molecules with potential therapeutic properties.
Used in Organic Chemistry:
Organic chemists utilize [1,3-dibenzoyloxy-1-(2-phenyltriazol-4-yl)propan-2-yl] benzoate as a reactant or starting material in various chemical reactions to explore its reactivity and potential for creating novel organic compounds.
Used in Drug Development:
[1,3-dibenzoyloxy-1-(2-phenyltriazol-4-yl)propan-2-yl] benzoate may be used as a key component in the development of new drugs, particularly those targeting specific biological pathways or receptors due to its structural diversity and potential for modification.
Used in Material Science:
In material science, [1,3-dibenzoyloxy-1-(2-phenyltriazol-4-yl)propan-2-yl] benzoate could be employed as a component in the design and synthesis of new materials with unique properties, such as improved stability, reactivity, or biocompatibility.
Please note that the specific applications and uses mentioned above are hypothetical and would require further research, development, and validation through laboratory testing and analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 7599-19-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,9 and 9 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 7599-19:
(6*7)+(5*5)+(4*9)+(3*9)+(2*1)+(1*9)=141
141 % 10 = 1
So 7599-19-1 is a valid CAS Registry Number.
InChI:InChI=1/C32H25N3O6/c36-30(23-13-5-1-6-14-23)39-22-28(40-31(37)24-15-7-2-8-16-24)29(41-32(38)25-17-9-3-10-18-25)27-21-33-35(34-27)26-19-11-4-12-20-26/h1-21,28-29H,22H2