76006-07-0 Usage
General Description
5-Methoxy-1H-pyrazolo[3,4-c]pyridine is a chemical compound with a molecular formula C8H7N3O. It is a heterocyclic compound that consists of a pyrazole ring fused to a pyridine ring, with a methoxy group attached to the pyridine ring. 5-METHOXY-1H-PYRAZOLO[3,4-C]PYRIDINE is primarily used in medicinal chemistry and pharmaceutical research as a building block for the synthesis of various biologically active molecules, particularly in the development of potential drugs targeting the central nervous system. Its unique structure and functional groups make it a valuable intermediate in the production of potential therapeutic agents. Additionally, it may also have applications in other scientific fields such as agrochemicals and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 76006-07-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,0,0 and 6 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 76006-07:
(7*7)+(6*6)+(5*0)+(4*0)+(3*6)+(2*0)+(1*7)=110
110 % 10 = 0
So 76006-07-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3O/c1-11-7-2-5-3-9-10-6(5)4-8-7/h2-4H,1H3,(H,9,10)
76006-07-0Relevant articles and documents
THERAPEUTIC INHIBITORY COMPOUNDS
-
, (2018/03/26)
Provided herein are heterocyclic derivative compounds and pharmaceutical compositions comprising said compounds that are useful for inhibiting plasma kallikrein. Furthermore, the subject compounds and compositions are useful for the treatment of diseases wherein the inhibition of plasma kallikrein inhibition has been implicated, such as angioedema and the like.