76014-78-3 Usage
Description
[3-benzofuro[2,3-c][1]benzoxepin-12(6H)-ylidenepropyl]dimethylammonium hydrogen fumarate is a complex organic compound that features a benzofuran and a benzoxepine ring system. It also incorporates a dimethylammonium group and a hydrogen fumarate salt. [3-benzofuro[2,3-c][1]benzoxepin-12(6H)-ylidenepropyl]dimethylammonium hydrogen fumarate is likely to have pharmaceutical or medicinal applications due to the presence of an amine and a fumarate group, which are common in drug molecules. Further chemical analysis and experimentation would be necessary to determine its specific properties and uses.
Uses
Used in Pharmaceutical Industry:
[3-benzofuro[2,3-c][1]benzoxepin-12(6H)-ylidenepropyl]dimethylammonium hydrogen fumarate is used as a potential pharmaceutical compound for its possible medicinal applications. The presence of an amine and a fumarate group suggests that it could be involved in the treatment or management of certain health conditions. However, further research is required to confirm its efficacy and safety.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, [3-benzofuro[2,3-c][1]benzoxepin-12(6H)-ylidenepropyl]dimethylammonium hydrogen fumarate can be used as a starting point for the development of new drugs. Its unique structure, which includes both a benzofuran and a benzoxepine ring system, may provide novel opportunities for drug design and optimization.
Used in Chemical Synthesis:
This complex organic compound may also be used in chemical synthesis for the creation of other related compounds with potential applications in various industries, such as agriculture, materials science, or environmental science. The specific reactivity and properties of the compound would need to be explored to determine its suitability for these applications.
Check Digit Verification of cas no
The CAS Registry Mumber 76014-78-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,0,1 and 4 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 76014-78:
(7*7)+(6*6)+(5*0)+(4*1)+(3*4)+(2*7)+(1*8)=123
123 % 10 = 3
So 76014-78-3 is a valid CAS Registry Number.
InChI:InChI=1/C21H21NO2.C4H4O4/c1-22(2)13-7-10-16-15-8-3-5-11-18(15)23-14-20-21(16)17-9-4-6-12-19(17)24-20;5-3(6)1-2-4(7)8/h3-6,8-12H,7,13-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b16-10-;2-1+