760947-12-4 Usage
Description
6-Bromo-4-chloro-2-(2-fluoro-phenyl)-quinazoline is a chemical compound that belongs to the quinazoline group, characterized by the presence of bromine, chlorine, and fluoro-phenyl groups in its molecular structure. It is a promising candidate for pharmaceutical research and development, as well as a potential building block in organic synthesis and chemical reactions for creating novel compounds with diverse properties and applications.
Uses
Used in Pharmaceutical Research and Development:
6-BROMO-4-CHLORO-2-(2-FLUORO-PHENYL)-QUINAZOLINE is used as a potential drug candidate for the development of new pharmaceuticals, leveraging its unique molecular structure and properties to target specific biological pathways and diseases.
Used in Organic Synthesis and Chemical Reactions:
6-BROMO-4-CHLORO-2-(2-FLUORO-PHENYL)-QUINAZOLINE is used as a building block in organic synthesis and chemical reactions, enabling the creation of novel compounds with a wide range of properties and applications.
Used in Agrochemical Development:
6-BROMO-4-CHLORO-2-(2-FLUORO-PHENYL)-QUINAZOLINE is used as a potential component in the development of agrochemicals, where its unique properties may contribute to the creation of new pesticides, herbicides, or other agricultural products.
Used in Materials Science:
6-BROMO-4-CHLORO-2-(2-FLUORO-PHENYL)-QUINAZOLINE is used in materials science for the development of new materials with specific properties, such as improved stability, reactivity, or other characteristics that may be beneficial in various applications.
Further research and testing are necessary to fully understand the potential applications and properties of 6-BROMO-4-CHLORO-2-(2-FLUORO-PHENYL)-QUINAZOLINE, as its unique molecular structure and potential uses across different industries require in-depth investigation to unlock its full potential.
Check Digit Verification of cas no
The CAS Registry Mumber 760947-12-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,6,0,9,4 and 7 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 760947-12:
(8*7)+(7*6)+(6*0)+(5*9)+(4*4)+(3*7)+(2*1)+(1*2)=184
184 % 10 = 4
So 760947-12-4 is a valid CAS Registry Number.
InChI:InChI=1S/C14H7BrClFN2/c15-8-5-6-12-10(7-8)13(16)19-14(18-12)9-3-1-2-4-11(9)17/h1-7H
