763120-55-4 Usage
General Description
Boronic acid, B-1H-pyrrol-3-yl- is a chemical compound with the molecular formula C4H6BNO2. It is a boronic acid derivative containing a pyrrole ring, which makes it structurally and functionally versatile. Boronic acids are known for their ability to form covalent bonds with diol-containing biomolecules, such as sugars and nucleic acids, making them valuable building blocks for chemical biology and medicinal chemistry. The presence of the pyrrole ring further enhances the potential applications of this compound, as pyrrole-based molecules have been investigated for their pharmacological activities, such as anti-inflammatory, antimicrobial, and anticancer properties. Therefore, Boronic acid, B-1H-pyrrol-3-yl- holds promise for various research and industrial applications in the fields of chemistry, biochemistry, and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 763120-55-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,6,3,1,2 and 0 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 763120-55:
(8*7)+(7*6)+(6*3)+(5*1)+(4*2)+(3*0)+(2*5)+(1*5)=144
144 % 10 = 4
So 763120-55-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H6BNO2/c7-5(8)4-1-2-6-3-4/h1-3,6-8H
