76433-27-7 Usage
General Description
STYRYL 6 is a chemical compound that belongs to the styryl dye family, which is widely used in various applications such as fluorescence microscopy, flow cytometry, and labeling of biomolecules. It is known for its high photostability and brightness, making it ideal for long-term imaging and quantification of biological samples. STYRYL 6 is also used as a fluorescent probe for detecting membrane potential changes in biological cells, making it a valuable tool for studying cell physiology and function. Additionally, it has been incorporated into various sensor platforms for detecting and quantifying various analytes in complex sample matrices. Its versatility and reliability make STYRYL 6 a valuable tool in both research and industrial settings.
Check Digit Verification of cas no
The CAS Registry Mumber 76433-27-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,4,3 and 3 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 76433-27:
(7*7)+(6*6)+(5*4)+(4*3)+(3*3)+(2*2)+(1*7)=137
137 % 10 = 7
So 76433-27-7 is a valid CAS Registry Number.
InChI:InChI=1/C23H27N2.ClHO4/c1-23(2)20-11-7-8-12-21(20)25(5)22(23)13-9-6-10-18-14-16-19(17-15-18)24(3)4;2-1(3,4)5/h6-17H,1-5H3;(H,2,3,4,5)/q+1;/p-1