76823-79-5 Usage
Piperazine ring
A heterocyclic chemical structure consisting of six members with two nitrogen atoms, contributing to the compound's chemical stability and potential pharmacological activity.
Chlorophenyl group
A phenyl ring (a six-carbon ring with alternating single and double bonds) with a chlorine atom attached, which may influence the compound's reactivity and lipophilicity.
Benzyl group
A phenyl ring attached to a methyl group, providing steric hindrance and affecting the compound's solubility and interaction with other molecules.
Benzoylphenyl group
A phenyl ring with a carbonyl group (C=O) attached, which may contribute to the compound's binding affinity and pharmacological activity.
Butyrate group
A four-carbon carboxylic acid (COOH) chain, which can influence the compound's solubility, stability, and potential pharmacological effects.
Potential pharmacological effects
Due to its complex structure, 2-[2-[4-[(4-chlorophenyl)benzyl]piperazin-1-yl]ethoxy]ethyl 2-(3-benzoylphenyl)butyrate dihydrochloride may have potential pharmacological effects. However, further research is needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 76823-79-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,8,2 and 3 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 76823-79:
(7*7)+(6*6)+(5*8)+(4*2)+(3*3)+(2*7)+(1*9)=165
165 % 10 = 5
So 76823-79-5 is a valid CAS Registry Number.
InChI:InChI=1/C38H41ClN2O4.2ClH/c1-2-35(32-14-9-15-33(28-32)37(42)31-12-7-4-8-13-31)38(43)45-27-26-44-25-24-40-20-22-41(23-21-40)36(29-10-5-3-6-11-29)30-16-18-34(39)19-17-30;;/h3-19,28,35-36H,2,20-27H2,1H3;2*1H