770-08-1 Usage
Description
5-Ethylpyridine-2-carboxylic acid, with the chemical formula C7H7NO2 and CAS number 770-08-1, is an organic compound characterized by its brown solid appearance. It is a derivative of pyridine, featuring an ethyl group attached to the 5th position and a carboxylic acid group at the 2nd position. This unique structure endows it with specific chemical properties that make it valuable in various applications.
Uses
Used in Organic Synthesis:
5-Ethylpyridine-2-carboxylic acid is utilized as a key intermediate in the synthesis of various organic compounds. Its presence in the molecular structure allows for the formation of new chemical bonds and reactions, facilitating the creation of a wide range of products.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 5-Ethylpyridine-2-carboxylic acid serves as a building block for the development of new drugs. Its unique structure can be incorporated into medicinal compounds to enhance their therapeutic properties, potentially leading to the discovery of novel treatments for various diseases.
Used in Chemical Research:
5-Ethylpyridine-2-carboxylic acid is also employed as a research tool in chemical laboratories. It can be used to study the properties of pyridine derivatives and their interactions with other molecules, contributing to a deeper understanding of chemical reactions and mechanisms.
Used in Material Science:
5-ETHYLPYRIDINE-2-CARBOXYLIC ACID may also find applications in material science, where it could be used to develop new materials with specific properties. Its incorporation into polymers or other materials could lead to the creation of innovative products with unique characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 770-08-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,7 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 770-08:
(5*7)+(4*7)+(3*0)+(2*0)+(1*8)=71
71 % 10 = 1
So 770-08-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO2/c1-2-6-3-4-7(8(10)11)9-5-6/h3-5H,2H2,1H3,(H,10,11)
