771573-27-4 Usage
Description
[4-(2-FURYL)PHENYL]METHYLAMINE is an organic compound that serves as a key reactant in the synthesis of various chemical compounds, particularly those with potential pharmaceutical applications. It is characterized by its unique molecular structure, which features a furyl group attached to a phenyl ring, with a methylamine group connected to the phenyl ring as well. This structure endows [4-(2-FURYL)PHENYL]METHYLAMINE with specific chemical properties that make it a valuable intermediate in the development of new drugs and other chemical products.
Uses
Used in Pharmaceutical Industry:
[4-(2-FURYL)PHENYL]METHYLAMINE is used as a reactant for the preparation of trisubstituted purine derivatives, which exhibit significant anticancer activity. These derivatives act as cyclin-dependent kinase inhibitors, playing a crucial role in the regulation of cell cycle progression and the prevention of uncontrolled cell growth, a hallmark of cancer.
The application of [4-(2-FURYL)PHENYL]METHYLAMINE in the pharmaceutical industry is primarily focused on its use in the synthesis of these anticancer agents. By inhibiting the activity of cyclin-dependent kinases, these trisubstituted purine derivatives can potentially halt the progression of cancer cells, offering a promising avenue for the development of novel cancer treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 771573-27-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,1,5,7 and 3 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 771573-27:
(8*7)+(7*7)+(6*1)+(5*5)+(4*7)+(3*3)+(2*2)+(1*7)=184
184 % 10 = 4
So 771573-27-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO/c12-8-9-3-5-10(6-4-9)11-2-1-7-13-11/h1-7H,8,12H2
