773123-81-2 Usage
General Description
The chemical 3-(N-Cbz-Piperidin-4-yl)-3-aminopropanoic acid is a compound with a complex molecular structure. It consists of a piperidine ring with a Cbz (carboxybenzyl) protecting group attached to the nitrogen atom, and a 3-aminopropanoic acid functional group. 3-(N-Cbz-Piperidin-4-yl)-3-aminopropanoic acid is commonly used in organic synthesis as a building block for the preparation of various pharmaceuticals and biologically active molecules. It can be utilized for the development of drugs targeting specific biological pathways and has potential applications in medicinal chemistry and drug discovery. Overall, the chemical possesses significant synthetic utility and pharmacological potential.
Check Digit Verification of cas no
The CAS Registry Mumber 773123-81-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,3,1,2 and 3 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 773123-81:
(8*7)+(7*7)+(6*3)+(5*1)+(4*2)+(3*3)+(2*8)+(1*1)=162
162 % 10 = 2
So 773123-81-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H22N2O4/c19-15(20)10-14(13-6-8-17-9-7-13)18-16(21)22-11-12-4-2-1-3-5-12/h1-5,13-14,17H,6-11H2,(H,18,21)(H,19,20)