7739-33-5 Usage
Class of compound
borazine derivative
Components
contains boron, nitrogen, and hydrogen atoms
Usage
typically used as a precursor in the synthesis of boron nitride thin films and nanoparticles
Structure
unique structure with three isopropyl and three ethyl groups attached to the boron and nitrogen atoms
Steric hindrance
highly sterically hindered molecule
Potential applications
in the fields of materials science, catalysis, and chemical vapor deposition
Stability
has potential applications due to its stability
Structure formation
ability to form tight and rigid structures
Check Digit Verification of cas no
The CAS Registry Mumber 7739-33-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,7,3 and 9 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 7739-33:
(6*7)+(5*7)+(4*3)+(3*9)+(2*3)+(1*3)=125
125 % 10 = 5
So 7739-33-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H36B3N3/c1-10-19-16(13(4)5)20(11-2)18(15(8)9)21(12-3)17(19)14(6)7/h13-15H,10-12H2,1-9H3
