7762-35-8 Usage
Chemical compound
A substance formed by a chemical reaction, consisting of a specific arrangement of atoms and characterized by its unique properties.
Pharmaceutical and medicinal applications
1-[2-(Methylphenylamino)ethyl]guanidine can be used in the development of drugs and medicines due to its potential therapeutic properties.
Guanidine derivative
A compound derived from guanidine, which is an organic compound containing a functional group with three amine groups attached to a central nitrogen atom.
Substituted phenylaminoethyl group
A functional group consisting of a phenyl ring attached to an aminoethyl group, which is then connected to the guanidine moiety in 1-[2-(Methylphenylamino)ethyl]guanidine.
Biological process modulation
The ability of 1-[2-(Methylphenylamino)ethyl]guanidine to influence and regulate various biological processes, such as neurotransmitter regulation and enzyme inhibition.
Therapeutic properties
The potential for 1-[2-(Methylphenylamino)ethyl]guanidine to be used in the treatment or management of diseases or medical conditions.
Neurotransmitter regulation
The ability of 1-[2-(Methylphenylamino)ethyl]guanidine to modulate the levels or activity of neurotransmitters, which are chemical messengers that transmit signals in the nervous system.
Enzyme inhibition
The potential for 1-[2-(Methylphenylamino)ethyl]guanidine to inhibit the activity of certain enzymes, which are proteins that catalyze biochemical reactions.
Antibacterial properties
The potential for 1-[2-(Methylphenylamino)ethyl]guanidine to inhibit the growth or activity of bacteria, making it a candidate for use in the development of antibacterial drugs.
Antifungal properties
The potential for 1-[2-(Methylphenylamino)ethyl]guanidine to inhibit the growth or activity of fungi, making it a candidate for use in the development of antifungal drugs.
Drug discovery and development
The process of identifying and developing new drugs, which may involve the study and application of compounds like 1-[2-(Methylphenylamino)ethyl]guanidine.
Chemical structure
The specific arrangement of atoms and bonds in a molecule, which determines the properties and reactivity of the compound.
Medicinal chemistry
A branch of chemistry that involves the study of chemical compounds that have biological or medicinal applications, such as the development of drugs and pharmaceuticals.
Pharmacology
The study of the interactions between drugs and living systems, including their mechanisms of action, effects, and therapeutic uses.
Check Digit Verification of cas no
The CAS Registry Mumber 7762-35-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,7,6 and 2 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 7762-35:
(6*7)+(5*7)+(4*6)+(3*2)+(2*3)+(1*5)=118
118 % 10 = 8
So 7762-35-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H16N4/c1-14(8-7-13-10(11)12)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H4,11,12,13)
