78720-96-4 Usage
Molecular Structure
1H-Purine-2,6-dione, 3,7-dihydro-7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(ethyl(phenylmethyl)amino)has a complex molecular structure that includes a purine ring and a side chain with various functional groups.
Purine Ring
The compound contains a purine ring, which is a bicyclic structure consisting of a six-membered and a five-membered nitrogen-containing ring.
Oxygen Atoms
The purine ring has two oxygen atoms, which contribute to the compound's chemical properties and reactivity.
Side Chain
The compound has a side chain that includes a dihydroxypropyl group, two methyl groups, and an ethyl(phenylmethyl)amino group, which are responsible for its unique properties and potential applications.
Dihydroxypropyl Group
The side chain contains a 2,3-dihydroxypropyl group, which is a three-carbon chain with two hydroxyl groups.
Ethyl(Phenylmethyl)amino Group
The side chain also includes an ethyl(phenylmethyl)amino group, which is an organic functional group consisting of an ethyl group and a phenylmethyl group connected by an amino group.
Derivative of Purine
This compound is a derivative of purine, which is a naturally occurring compound found in various biological molecules, such as nucleotides and nucleic acids.
Xanthine Derivatives
1H-Purine-2,6-dione, 3,7-dihydro-7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(ethyl(phenylmethyl)amino)belongs to the group of xanthine derivatives, which are compounds related to xanthine, a naturally occurring purine derivative.
Pharmaceutical and Research Applications
Due to its unique structure and potential biological activities, this compound may have applications in pharmaceuticals or research, although further studies are needed to determine its specific uses and efficacy.
Check Digit Verification of cas no
The CAS Registry Mumber 78720-96-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,7,2 and 0 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 78720-96:
(7*7)+(6*8)+(5*7)+(4*2)+(3*0)+(2*9)+(1*6)=164
164 % 10 = 4
So 78720-96-4 is a valid CAS Registry Number.
InChI:InChI=1/C19H25N5O4/c1-4-23(10-13-8-6-5-7-9-13)18-20-16-15(24(18)11-14(26)12-25)17(27)22(3)19(28)21(16)2/h5-9,14,25-26H,4,10-12H2,1-3H3