78969-69-4 Usage
General Description
2,4,6-triiodo-3-acetamidobenzoic acid (N-cyclohexylcarbamyloxy)ethyl ester is a complex chemical compound that contains three iodine atoms, and its molecular structure includes a benzene ring with an acetamido group and a carboxylic acid group. The compound also contains a cyclohexylcarbamoyloxyethyl ester group, which is a derivative of carboxylic acid. This chemical has potential applications in the field of medicine, particularly in diagnostic imaging studies such as computed tomography (CT) scans, where the presence of iodine aids in enhancing the visibility of certain tissues and organs. Additionally, its specific molecular structure and functional groups make it a useful tool for research and studies in organic chemistry and pharmaceutical development.
Check Digit Verification of cas no
The CAS Registry Mumber 78969-69-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,9,6 and 9 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 78969-69:
(7*7)+(6*8)+(5*9)+(4*6)+(3*9)+(2*6)+(1*9)=214
214 % 10 = 4
So 78969-69-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H21I3N2O5/c1-10(24)22-16-13(20)9-12(19)14(15(16)21)17(25)27-7-8-28-18(26)23-11-5-3-2-4-6-11/h9,11H,2-8H2,1H3,(H,22,24)(H,23,26)