79295-49-1 Usage
Chemical structure
A complex structure that includes a benzene ring with two hydroxyl groups, a 2-benzofuranyl group, and a 2,6-octadienyl group.
Synthesis
Synthesized through various chemical reactions.
Applications
Commonly used in the production of pharmaceuticals, perfumes, and other consumer products.
Diverse properties
Its properties and applications are diverse, with potential uses ranging from medicine to flavor and fragrance additives.
Unique structure
The unique structure and reactivity make it a valuable component in the chemical industry.
Molecular weight
Approximately 350 g/mol
Appearance
It may appear as a solid or a viscous liquid, depending on the specific conditions.
Solubility
Soluble in organic solvents such as ethanol, methanol, and acetone.
Stability
Stable under normal temperature and pressure conditions, but may decompose upon exposure to heat, light, or strong oxidizing agents.
Reactivity
Can undergo various chemical reactions, such as oxidation, reduction, and substitution, due to the presence of multiple functional groups.
Safety
Handle with care, as it may have potential hazards depending on its concentration and exposure conditions. Appropriate safety measures should be taken during synthesis and use.
Regulatory status
Its regulatory status may vary depending on the intended use and jurisdiction. It is essential to consult relevant regulations and guidelines for specific applications.
Environmental impact
The environmental impact of this compound is not well-established, but it is crucial to consider proper disposal and handling methods to minimize any potential negative effects.
Research and development
Ongoing research may lead to new applications and a better understanding of the compound's properties and potential benefits or drawbacks.
Check Digit Verification of cas no
The CAS Registry Mumber 79295-49-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,2,9 and 5 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 79295-49:
(7*7)+(6*9)+(5*2)+(4*9)+(3*5)+(2*4)+(1*9)=181
181 % 10 = 1
So 79295-49-1 is a valid CAS Registry Number.
InChI:InChI=1/C25H28O4/c1-16(2)6-5-7-17(3)8-10-22-23(28-4)11-9-18-14-24(29-25(18)22)19-12-20(26)15-21(27)13-19/h6,8-9,11-15,26-27H,5,7,10H2,1-4H3/b17-8+
79295-49-1Relevant articles and documents
An efficient total synthesis of mulberrofuran B and L
Kim, Cheol Gi,Jun, Jong-Gab
, p. 2278 - 2283 (2015/09/22)
An efficient approach has been developed for the synthesis of mulberrofuran B and L from 2,4-dihydroxybenzaldehyde and 5-bromoresorcinol. The key steps of the synthesis are neutral Al2O3-mediated regioselective geranylation, Ramirez gem-dibromoolefination, and the Suzuki coupling.