79671-78-6 Usage
Description
C-ADAMANTAN-2-YL-METHYLAMINE HYDROCHLORIDE is a chemical compound derived from adamantane, a diamondoid hydrocarbon, and is used as a building block in organic synthesis and pharmaceutical research for creating various molecules and compounds. Its hydrochloride form offers stability and water solubility, facilitating easier handling in laboratory settings.
Uses
Used in Pharmaceutical Research:
C-ADAMANTAN-2-YL-METHYLAMINE HYDROCHLORIDE is used as a building block for the synthesis of potential pharmaceuticals and bioactive compounds due to its unique structure and properties, making it a valuable tool in the field of organic chemistry and medicinal research.
Used in Organic Synthesis:
In the field of organic synthesis, C-ADAMANTAN-2-YL-METHYLAMINE HYDROCHLORIDE is utilized as a key component for creating a variety of molecules and compounds, contributing to the development of new chemical entities and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 79671-78-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,6,7 and 1 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 79671-78:
(7*7)+(6*9)+(5*6)+(4*7)+(3*1)+(2*7)+(1*8)=186
186 % 10 = 6
So 79671-78-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H19N/c12-6-11-9-2-7-1-8(4-9)5-10(11)3-7/h7-11H,1-6,12H2