79673-54-4 Usage
General Description
1,4-dimethyl-1H-pyrrole-2-acetic acid is a chemical compound with the molecular formula C8H11NO2. It is a derivative of pyrrole and contains a carboxylic acid functional group. The compound is commonly used as a building block in organic synthesis and can be found in some natural products. It has been studied for its potential biological and pharmacological properties, including its role in inhibiting the enzyme heme oxygenase-1, which is involved in various physiological processes. Additionally, 1,4-dimethyl-1H-pyrrole-2-acetic acid has shown potential as a therapeutic agent for conditions such as inflammation, cancer, and cardiovascular disease.
Check Digit Verification of cas no
The CAS Registry Mumber 79673-54-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,6,7 and 3 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 79673-54:
(7*7)+(6*9)+(5*6)+(4*7)+(3*3)+(2*5)+(1*4)=184
184 % 10 = 4
So 79673-54-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO2/c1-6-3-7(4-8(10)11)9(2)5-6/h3,5H,4H2,1-2H3,(H,10,11)
