79759-71-0 Usage
General Description
"2H-Benzimidazol-2-one, 1,3-dihydro-6-chloro-1-(2-methylphenyl)-" is a chemical compound with the molecular formula C14H11ClN2O. It is a derivative of benzimidazole and is structurally similar to famotidine, a drug used to treat ulcers and gastroesophageal reflux disease. 2H-Benzimidazol-2-one, 1,3-dihydro-6-chloro-1-(2-methylphenyl)- has potential pharmaceutical applications due to its structural similarity to famotidine and its potential ability to interact with histamine receptors in the body. Its specific chemical properties and potential uses would need to be further investigated through research and experimentation.
Check Digit Verification of cas no
The CAS Registry Mumber 79759-71-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,7,5 and 9 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 79759-71:
(7*7)+(6*9)+(5*7)+(4*5)+(3*9)+(2*7)+(1*1)=200
200 % 10 = 0
So 79759-71-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H11ClN2O/c1-9-4-2-3-5-12(9)17-13-8-10(15)6-7-11(13)16-14(17)18/h2-8H,1H3,(H,16,18)