80018-20-8 Usage
Description
(6E)-4-chloro-6-[(2-chlorophenyl)-(tetradecylamino)methylidene]cyclohexa-2,4-dien-1-one is a complex chemical compound belonging to the cyclohexa-2,4-dien-1-one family. It features a cyclohexa-2,4-dien-1-one core with a chloro and a (2-chlorophenyl)-(tetradecylamino)methylidene group attached, which may endow the molecule with unique chemical and biological properties. Further research is required to explore its potential applications and effects.
Uses
Since the provided materials do not specify any particular applications for (6E)-4-chloro-6-[(2-chlorophenyl)-(tetradecylamino)methylidene]cyclohexa-2,4-dien-1-one, we can only hypothesize potential uses based on its chemical structure and the properties of similar compounds. Here are some possible applications:
Used in Pharmaceutical Industry:
(6E)-4-chloro-6-[(2-chlorophenyl)-(tetradecylamino)methylidene]cyclohexa-2,4-dien-1-one could be used as an active pharmaceutical ingredient for the development of new drugs, given its complex structure and potential for diverse biological activities.
Used in Chemical Research:
(6E)-4-chloro-6-[(2-chlorophenyl)-(tetradecylamino)methylidene]cyclohe xa-2,4-dien-1-one might serve as a starting material or intermediate in the synthesis of other complex organic molecules, contributing to the advancement of chemical research and the development of novel chemical entities.
Used in Material Science:
The unique structure of (6E)-4-chloro-6-[(2-chlorophenyl)-(tetradecylamino)methylidene]cyclohexa-2,4-dien-1-one could potentially be exploited in the design of new materials with specific properties, such as improved stability or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 80018-20-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,0,1 and 8 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 80018-20:
(7*8)+(6*0)+(5*0)+(4*1)+(3*8)+(2*2)+(1*0)=88
88 % 10 = 8
So 80018-20-8 is a valid CAS Registry Number.
InChI:InChI=1/C27H37Cl2NO/c1-2-3-4-5-6-7-8-9-10-11-12-15-20-30-27(23-16-13-14-17-25(23)29)24-21-22(28)18-19-26(24)31/h13-14,16-19,21,30H,2-12,15,20H2,1H3/b27-24+