80106-53-2 Usage
Description
(bicyclo(2.2.1)hept-2-ylidene)acetamide is a heterocyclic chemical compound with the molecular formula C9H13NO. It features a unique bicyclic ring system and an acetamide functional group, which contribute to its distinct structure and properties. (bicyclo(2.2.1)hept-2-ylidene)acetamide holds potential for applications in organic synthesis and medicinal chemistry, making it a subject of interest for chemical research and development.
Uses
Used in Organic Synthesis:
(bicyclo(2.2.1)hept-2-ylidene)acetamide is used as a building block for the synthesis of various complex organic molecules. Its unique bicyclic ring system and acetamide group provide a versatile platform for further chemical modifications and the creation of novel compounds with potential applications in different fields.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (bicyclo(2.2.1)hept-2-ylidene)acetamide is used as a starting material for the development of new pharmaceuticals. Its structural features may be exploited to design and synthesize bioactive molecules with potential therapeutic applications, such as drugs targeting specific diseases or conditions.
Used in Chemical Research and Development:
(bicyclo(2.2.1)hept-2-ylidene)acetamide serves as an interesting target for chemical research and development. Its unique structure and reactivity make it a valuable compound for studying various chemical reactions and mechanisms, which can lead to the discovery of new synthetic methods and the development of innovative materials and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 80106-53-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,1,0 and 6 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 80106-53:
(7*8)+(6*0)+(5*1)+(4*0)+(3*6)+(2*5)+(1*3)=92
92 % 10 = 2
So 80106-53-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H13NO/c10-9(11)5-8-4-6-1-2-7(8)3-6/h5-7H,1-4H2,(H2,10,11)/b8-5+