80336-34-1 Usage
Description
(4-Chloro-2-tetradecylphenoxy)acetyl chloride is a chemical compound characterized by the molecular formula C20H32ClO2. It is a chlorinated acetyl chloride derivative featuring a tetradecylphenoxy group attached, which contributes to its unique chemical properties and reactivity.
Uses
Used in Organic Synthesis:
(4-Chloro-2-tetradecylphenoxy)acetyl chloride is utilized as a reagent in organic synthesis for the preparation of a variety of organic compounds. Its unique structure allows it to participate in numerous chemical reactions, making it a valuable tool in the creation of complex molecules.
Used in Pharmaceutical Production:
In the pharmaceutical industry, (4-Chloro-2-tetradecylphenoxy)acetyl chloride is used as a key intermediate in the synthesis of various drugs. Its ability to form a wide range of chemical bonds makes it a versatile building block for the development of new medicinal compounds.
Used in Agrochemical Production:
(4-Chloro-2-tetradecylphenoxy)acetyl chloride also finds application in the agrochemical sector, where it is employed in the synthesis of different agrochemical products. Its role in creating specific chemical structures is crucial for the development of effective and targeted agrochemicals.
Used in Specialty Chemicals:
(4-Chloro-2-tetradecylphenoxy)acetyl chloride is also used in the production of specialty chemicals, which are tailored for specific industries and applications. The unique properties of (4-Chloro-2-tetradecylphenoxy)acetyl chloride make it suitable for creating custom chemical solutions for various market needs.
Safety Precautions:
Check Digit Verification of cas no
The CAS Registry Mumber 80336-34-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,3,3 and 6 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 80336-34:
(7*8)+(6*0)+(5*3)+(4*3)+(3*6)+(2*3)+(1*4)=111
111 % 10 = 1
So 80336-34-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H34Cl2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-17-20(23)15-16-21(19)26-18-22(24)25/h15-17H,2-14,18H2,1H3