80352-63-2 Usage
General Description
(3-Amino-pyridin-2-yl)-aceticacid is a chemical compound with the molecular formula C7H8N2O2. It is a derivative of pyridine and contains both an amino group and a carboxylic acid group. (3-Amino-pyridin-2-yl)-acetic acid has potential applications in the field of organic synthesis and pharmaceutical research, as it can be used as a building block in the synthesis of various compounds. Additionally, it may have biological activity due to its structural similarity to certain amino acids and neurotransmitters. Further research and experimentation are necessary to fully understand the potential uses and effects of (3-Amino-pyridin-2-yl)-acetic acid.
Check Digit Verification of cas no
The CAS Registry Mumber 80352-63-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,3,5 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 80352-63:
(7*8)+(6*0)+(5*3)+(4*5)+(3*2)+(2*6)+(1*3)=112
112 % 10 = 2
So 80352-63-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2/c8-5-2-1-3-9-6(5)4-7(10)11/h1-3H,4,8H2,(H,10,11)
