80353-94-2 Usage
General Description
7-Methyl-Imidazo[1,2-a]pyridine-2-carboxylic acid is a chemical compound that belongs to the class of organic compounds known as heteroaromatic compounds. These compounds are aromatic heterocyclic derivatives that contain a ring structure with two or more atoms, of which at least one is a carbon atom balanced by one or more heteroatoms. Its physical properties and functionality can be studied for research purposes, and it is often recognized for its relevance in medicinal chemistry due to its potential pharmaceutical properties. However, detailed information on its biological activities or safety profiles is limited and more research is needed to fully determine its potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 80353-94-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,3,5 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 80353-94:
(7*8)+(6*0)+(5*3)+(4*5)+(3*3)+(2*9)+(1*4)=122
122 % 10 = 2
So 80353-94-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O2/c1-6-2-3-11-5-7(9(12)13)10-8(11)4-6/h2-5H,1H3,(H,12,13)
