80568-60-1 Usage
Molecular structure
The compound has a thioxanthene ring system and a dimethylaminopropylamino group.
Fluorescent dye
It is commonly used as a fluorescent dye for various applications, including in biological and medical research.
Intense fluorescence
The compound is known for its ability to emit intense fluorescence when exposed to ultraviolet light.
Labeling and tracking
It is useful for labeling and tracking specific cellular and molecular processes.
Photodynamic therapy
It has potential applications in photodynamic therapy.
Photosensitizer
It can be used as a photosensitizer for biomedical imaging.
Complex structure
The compound has a complex structure.
Potential reactivity
Due to its complex structure and potential reactivity, it requires careful handling and storage.
Degradation prevention
Proper handling and storage are necessary to prevent degradation and ensure its effectiveness in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 80568-60-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,5,6 and 8 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 80568-60:
(7*8)+(6*0)+(5*5)+(4*6)+(3*8)+(2*6)+(1*0)=141
141 % 10 = 1
So 80568-60-1 is a valid CAS Registry Number.
InChI:InChI=1/C19H22N2O2S/c1-12-11-14(22)17(20-9-6-10-21(2)3)16-18(23)13-7-4-5-8-15(13)24-19(12)16/h4-5,7-8,11,20,22H,6,9-10H2,1-3H3