80709-63-3 Usage
Chemical class
Tricyclic antidepressant (TCA) A type of medication used to treat major depressive disorder and other mood disorders.
Mechanism of action
Increases levels of serotonin and norepinephrine in the brain This compound works by increasing the levels of these neurotransmitters, which helps regulate mood and emotions.
Indications
Treatment of psychiatric disorders It is used to treat various psychiatric conditions, such as depression, anxiety, and bipolar disorder.
Salt form
Maleate salt The maleate salt form of the compound is more stable and soluble, making it easier to formulate into pharmaceutical products.
Prescription
Typically prescribed by healthcare professionals It is usually prescribed by doctors or other healthcare professionals to improve the symptoms of depression and other mood disorders.
Molecular structure
10,11-Dihydro-3,7-dimethoxydibenzo(b,f)thiepin-10-yl This part of the molecule is responsible for its tricyclic antidepressant properties.
Piperazine component
4-methylpiperazine This component is a common feature in many tricyclic antidepressants and contributes to the compound's activity.
Check Digit Verification of cas no
The CAS Registry Mumber 80709-63-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,7,0 and 9 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 80709-63:
(7*8)+(6*0)+(5*7)+(4*0)+(3*9)+(2*6)+(1*3)=133
133 % 10 = 3
So 80709-63-3 is a valid CAS Registry Number.
InChI:InChI=1/C21H26N2O2S.C4H4O4/c1-22-8-10-23(11-9-22)19-12-15-4-5-16(24-2)13-20(15)26-21-14-17(25-3)6-7-18(19)21;5-3(6)1-2-4(7)8/h4-7,13-14,19H,8-12H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+