81012-91-1 Usage
Description
N-(GAMMA-L-GLUTAMYL)-ALPHA-NAPHTHYLAMIDE MONOHYDRATE, also known as L-Glutamic acid gamma-(alpha-naphthylamide) monohydrate, is a white to slightly pink-brown crystalline powder with unique chemical properties.
Uses
Used in Pharmaceutical Industry:
N-(GAMMA-L-GLUTAMYL)-ALPHA-NAPHTHYLAMIDE MONOHYDRATE is used as a pharmaceutical compound for its potential applications in drug development and research. Its unique chemical structure allows it to be utilized in the synthesis of various therapeutic agents and for studying the mechanisms of action of certain drugs.
Used in Research Applications:
In the field of research, N-(GAMMA-L-GLUTAMYL)-ALPHA-NAPHTHYLAMIDE MONOHYDRATE serves as a valuable tool for investigating the properties and functions of L-glutamic acid and its derivatives. It can be used to study the interactions between this compound and other biomolecules, as well as its role in various biological processes.
Used in Analytical Chemistry:
N-(GAMMA-L-GLUTAMYL)-ALPHA-NAPHTHYLAMIDE MONOHYDRATE is also used in analytical chemistry as a reagent for the detection and quantification of specific substances. Its unique chemical properties make it suitable for use in various analytical techniques, such as chromatography and spectroscopy, to accurately measure the presence and concentration of target compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 81012-91-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,0,1 and 2 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 81012-91:
(7*8)+(6*1)+(5*0)+(4*1)+(3*2)+(2*9)+(1*1)=91
91 % 10 = 1
So 81012-91-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H16N2O3/c16-12(15(19)20)8-9-14(18)17-13-7-3-5-10-4-1-2-6-11(10)13/h1-7,12H,8-9,16H2,(H,17,18)(H,19,20)/t12-/m0/s1
