811711-33-8 Usage
Description
1,2-DIBROMO-3-FLUORO-BENZENE is an organic compound with the chemical formula C6H3Br2F. It is a halogenated aromatic compound featuring two bromine atoms and one fluorine atom attached to a benzene ring. 1,2-DIBROMO-3-FLUORO-BENZENE is known for its reactivity and is commonly used as a building block in the synthesis of various organic compounds.
Uses
Used in Chemical Synthesis:
1,2-DIBROMO-3-FLUORO-BENZENE is used as a reactant or reagent in synthetic preparations, particularly for regioselective aryne cross-coupling of aryllithiums. This application is valuable in the production of complex organic molecules and pharmaceutical compounds, as it allows for the selective formation of specific chemical bonds and the creation of desired molecular structures.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1,2-DIBROMO-3-FLUORO-BENZENE serves as an intermediate in the synthesis of various drug molecules. Its unique structure and reactivity make it a valuable component in the development of new medications and therapeutic agents.
Used in Material Science:
1,2-DIBROMO-3-FLUORO-BENZENE is also utilized in material science for the development of novel materials with specific properties. Its incorporation into polymers and other materials can lead to enhanced characteristics such as improved stability, flame retardancy, or electrical conductivity, depending on the desired application.
Overall, 1,2-DIBROMO-3-FLUORO-BENZENE is a versatile compound with a wide range of applications across various industries, including chemical synthesis, pharmaceuticals, and material science. Its unique structure and reactivity make it an essential component in the development of new and innovative products.
Check Digit Verification of cas no
The CAS Registry Mumber 811711-33-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,1,1,7,1 and 1 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 811711-33:
(8*8)+(7*1)+(6*1)+(5*7)+(4*1)+(3*1)+(2*3)+(1*3)=128
128 % 10 = 8
So 811711-33-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Br2F/c7-4-2-1-3-5(9)6(4)8/h1-3H
811711-33-8Relevant articles and documents
Efficient and complementary methods offering access to synthetically valuable 1,2-dibromobenzenes
Diemer, Vincent,Leroux, Frederic R.,Colobert, Fracoise
experimental part, p. 327 - 340 (2011/02/26)
1,2-Dibromobenzenes are highly valuable precursors for various organic transformations, in particular, reactions based on the intermediate formation of benzynes. This report describes short sequences for the synthesis of various derivatives based on regioselective bromination, ortho-metalation, and halogen/metal permutations. 1,2-Dibromo-3-iodobenzene (2f), 1,2-dibromo-4- iodobenzene (4c), and 2,3-dibromo-1,4-diiodobenzene (5e) act as intermediates in these syntheses. Bromo-iodoarenes have been synthesized by short and regioselective bromination or iodination sequences that combine ortho-metalation, halo-desilylation, diazotation, or bromination reactions of anilines. These polyhalo derivatives were then used as key intermediates to access a wide range of functionalized 1,2-dibromobenzenes by chemoselective organometallic reactions. Copyright