81409-86-1 Usage
Description
(8-beta)-N-Cyclohexyl-N-((cyclohexylamino)carbonyl)-6-(2-propenyl)ergo line-8-carboxamide is a complex chemical compound belonging to the ergoline derivative class. It features a cyclohexyl and 2-propenyl group attached to an ergoline ring, which is a characteristic structure of ergoline alkaloids. These alkaloids are naturally occurring compounds found in certain fungi and plants. (8-beta)-N-Cyclohexyl-N-((cyclohexylamino)carbonyl)-6-(2-propenyl)ergo line-8-carboxamide is recognized for its potential applications in the field of neurological research and pharmaceutical development, particularly for conditions like migraines and Parkinson's disease. Its intricate chemical structure suggests that it may interact with various neurotransmitter systems in the brain, indicating its promise for further study and possible therapeutic uses.
Uses
Used in Pharmaceutical Development:
(8-beta)-N-Cyclohexyl-N-((cyclohexylamino)carbonyl)-6-(2-propenyl)ergo line-8-carboxamide is used as a research compound for the development of pharmaceuticals targeting neurological disorders. Its ergoline structure allows for the exploration of its interactions with neurotransmitter systems, which could lead to the creation of novel treatments for conditions such as migraines and Parkinson's disease.
Used in Neurological Research:
In the field of neurological research, (8-beta)-N-Cyclohexyl-N-((cyclohexylamino)carbonyl)-6-(2-propenyl)ergo line-8-carboxamide serves as a valuable tool for studying the complex interactions between neurotransmitters and their receptors in the brain. Understanding these interactions can provide insights into the underlying mechanisms of various neurological conditions and guide the development of more effective therapies.
Used in Drug Design and Synthesis:
(8-beta)-N-Cyclohexyl-N-((cyclohexylamino)carbonyl)-6-(2-propenyl)ergo line-8-carboxamide is also utilized in drug design and synthesis, where its unique structure can be modified or used as a template to create new molecules with potential therapeutic properties. This can lead to the discovery of new drugs with improved efficacy and fewer side effects for the treatment of neurological disorders.
Used in Chemical Synthesis and Modification:
(8-beta)-N-Cyclohexyl-N-((cyclohexylamino)carbonyl)-6-(2-propenyl)ergo line-8-carboxamide can be employed in chemical synthesis processes to create a variety of ergoline-based compounds. These synthesized compounds can then be tested for their potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 81409-86-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,4,0 and 9 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 81409-86:
(7*8)+(6*1)+(5*4)+(4*0)+(3*9)+(2*8)+(1*6)=131
131 % 10 = 1
So 81409-86-1 is a valid CAS Registry Number.
InChI:InChI=1/C31H42N4O2/c1-2-16-34-20-22(17-26-25-14-9-15-27-29(25)21(19-32-27)18-28(26)34)30(36)35(24-12-7-4-8-13-24)31(37)33-23-10-5-3-6-11-23/h2,9,14-15,19,22-24,26,28,32H,1,3-8,10-13,16-18,20H2,(H,33,37)/t22-,26?,28-/m1/s1