81853-83-0 Usage
Main properties
1. Synthetic compound
2. Belongs to the saframycin family of chemicals
3. Derived from natural product saframycin A
4. Exhibits potent cytotoxicity against cancer cell lines
5. Shows promising results in preclinical studies as a potential anticancer drug
6. Exhibits antibacterial activity against certain bacteria
7. Unique chemical structure
Specific content
21-decyano-25-dihydrosaframycin A is a synthetic compound derived from saframycin A
It has been synthesized to enhance its biological properties and potential as a therapeutic agent
Exhibits potent cytotoxicity against various cancer cell lines
Shows promising results in preclinical studies as an anticancer drug
Also exhibits antibacterial activity against certain bacteria
Possesses a unique chemical structure
Target for further research and development in medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 81853-83-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,8,5 and 3 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 81853-83:
(7*8)+(6*1)+(5*8)+(4*5)+(3*3)+(2*8)+(1*3)=150
150 % 10 = 0
So 81853-83-0 is a valid CAS Registry Number.
InChI:InChI=1/C28H33N3O8/c1-11-22(33)15-7-14-10-31-17(21(30(14)4)20(15)25(36)27(11)39-6)8-16-19(18(31)9-29-28(37)13(3)32)24(35)26(38-5)12(2)23(16)34/h13-14,17-18,21,32H,7-10H2,1-6H3,(H,29,37)